C19H21N3O3 — CID 119406678
N-[3-(3-aminopropylcarbamoyl)phenyl]-2,3-dihydro-1-benzofuran-2-carboxamide (PubChem CID 119406678) has the molecular formula C19H21N3O3 and a molecular weight of 339.40 g/mol. Its IUPAC name is N-[3-(3-aminopropylcarbamoyl)phenyl]-2,3-dihydro-1-benzofuran-2-carboxamide.
| Compound Name | N-[3-(3-aminopropylcarbamoyl)phenyl]-2,3-dihydro-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 119406678 |
| Molecular Formula | C19H21N3O3 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | N-[3-(3-aminopropylcarbamoyl)phenyl]-2,3-dihydro-1-benzofuran-2-carboxamide |
| SMILES | NCCCNC(=O)c1cccc(NC(=O)C2Cc3ccccc3O2)c1 |
| InChI | InChI=1S/C19H21N3O3/c20-9-4-10-21-18(23)14-6-3-7-15(11-14)22-19(24)17-12-13-5-1-2-8-16(13)25-17/h1-3,5-8,11,17H,4,9-10,12,20H2,(H,21,23)(H,22,24) |
| InChIKey | ODGPLVKDVCEUDH-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|