C25H30N2O4 — CID 55821329
N-[3-(3-cyclohexyloxypropylcarbamoyl)phenyl]-2,3-dihydro-1-benzofuran-2-carboxamide (PubChem CID 55821329) has the molecular formula C25H30N2O4 and a molecular weight of 422.53 g/mol. Its IUPAC name is N-[3-(3-cyclohexyloxypropylcarbamoyl)phenyl]-2,3-dihydro-1-benzofuran-2-carboxamide.
| Compound Name | N-[3-(3-cyclohexyloxypropylcarbamoyl)phenyl]-2,3-dihydro-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 55821329 |
| Molecular Formula | C25H30N2O4 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | N-[3-(3-cyclohexyloxypropylcarbamoyl)phenyl]-2,3-dihydro-1-benzofuran-2-carboxamide |
| SMILES | O=C(NCCCOC1CCCCC1)c1cccc(NC(=O)C2Cc3ccccc3O2)c1 |
| InChI | InChI=1S/C25H30N2O4/c28-24(26-14-7-15-30-21-11-2-1-3-12-21)19-9-6-10-20(16-19)27-25(29)23-17-18-8-4-5-13-22(18)31-23/h4-6,8-10,13,16,21,23H,1-3,7,11-12,14-15,17H2,(H,26,28)(H,27,29) |
| InChIKey | ZVQFYUQXTHWTQB-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|