C26H22F3N3O4 — CID 55793040
N-[3-[2-[[4-(trifluoromethyl)benzoyl]amino]ethylcarbamoyl]phenyl]-2,3-dihydro-1-benzofuran-2-carboxamide (PubChem CID 55793040) has the molecular formula C26H22F3N3O4 and a molecular weight of 497.47 g/mol. Its IUPAC name is N-[3-[2-[[4-(trifluoromethyl)benzoyl]amino]ethylcarbamoyl]phenyl]-2,3-dihydro-1-benzofuran-2-carboxamide.
| Compound Name | N-[3-[2-[[4-(trifluoromethyl)benzoyl]amino]ethylcarbamoyl]phenyl]-2,3-dihydro-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 55793040 |
| Molecular Formula | C26H22F3N3O4 |
| Molecular Weight | 497.47 g/mol |
| Exact Mass | 497.16 |
| IUPAC Name | N-[3-[2-[[4-(trifluoromethyl)benzoyl]amino]ethylcarbamoyl]phenyl]-2,3-dihydro-1-benzofuran-2-carboxamide |
| SMILES | O=C(NCCNC(=O)c1cccc(NC(=O)C2Cc3ccccc3O2)c1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C26H22F3N3O4/c27-26(28,29)19-10-8-16(9-11-19)23(33)30-12-13-31-24(34)18-5-3-6-20(14-18)32-25(35)22-15-17-4-1-2-7-21(17)36-22/h1-11,14,22H,12-13,15H2,(H,30,33)(H,31,34)(H,32,35) |
| InChIKey | WYJYGLLATPUAKH-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.47 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|