C22H24N2O5 — CID 119352210
6-[[3-(2,3-dihydro-1-benzofuran-2-carbonylamino)benzoyl]amino]hexanoic acid (PubChem CID 119352210) has the molecular formula C22H24N2O5 and a molecular weight of 396.44 g/mol. Its IUPAC name is 6-[[3-(2,3-dihydro-1-benzofuran-2-carbonylamino)benzoyl]amino]hexanoic acid.
| Compound Name | 6-[[3-(2,3-dihydro-1-benzofuran-2-carbonylamino)benzoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 119352210 |
| Molecular Formula | C22H24N2O5 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | 6-[[3-(2,3-dihydro-1-benzofuran-2-carbonylamino)benzoyl]amino]hexanoic acid |
| SMILES | O=C(O)CCCCCNC(=O)c1cccc(NC(=O)C2Cc3ccccc3O2)c1 |
| InChI | InChI=1S/C22H24N2O5/c25-20(26)11-2-1-5-12-23-21(27)16-8-6-9-17(13-16)24-22(28)19-14-15-7-3-4-10-18(15)29-19/h3-4,6-10,13,19H,1-2,5,11-12,14H2,(H,23,27)(H,24,28)(H,25,26) |
| InChIKey | FKBJYYHTDQMPKM-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|