C16H21BO5 — CID 142473007
methyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1-benzofuran-2-carboxylate (PubChem CID 142473007) has the molecular formula C16H21BO5 and a molecular weight of 304.15 g/mol. Its IUPAC name is methyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1-benzofuran-2-carboxylate.
| Compound Name | methyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 142473007 |
| Molecular Formula | C16H21BO5 |
| Molecular Weight | 304.15 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | methyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1-benzofuran-2-carboxylate |
| SMILES | COC(=O)C1Cc2cc(B3OC(C)(C)C(C)(C)O3)ccc2O1 |
| InChI | InChI=1S/C16H21BO5/c1-15(2)16(3,4)22-17(21-15)11-6-7-12-10(8-11)9-13(20-12)14(18)19-5/h6-8,13H,9H2,1-5H3 |
| InChIKey | FOAICUHNGKIVES-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.15 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|