C20H29BO5 — CID 175399838
2-[[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-2H-chromen-2-yl]methyl]butanoic acid (PubChem CID 175399838) has the molecular formula C20H29BO5 and a molecular weight of 360.26 g/mol. Its IUPAC name is 2-[[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-2H-chromen-2-yl]methyl]butanoic acid.
| Compound Name | 2-[[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-2H-chromen-2-yl]methyl]butanoic acid |
|---|---|
| PubChem CID | 175399838 |
| Molecular Formula | C20H29BO5 |
| Molecular Weight | 360.26 g/mol |
| Exact Mass | 360.21 |
| IUPAC Name | 2-[[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-2H-chromen-2-yl]methyl]butanoic acid |
| SMILES | CCC(CC1CCc2cc(B3OC(C)(C)C(C)(C)O3)ccc2O1)C(=O)O |
| InChI | InChI=1S/C20H29BO5/c1-6-13(18(22)23)12-16-9-7-14-11-15(8-10-17(14)24-16)21-25-19(2,3)20(4,5)26-21/h8,10-11,13,16H,6-7,9,12H2,1-5H3,(H,22,23) |
| InChIKey | FRIIBXUFWMLKQF-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.26 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|