C24H31BO3 — CID 123950237
4,4,5,5-tetramethyl-2-[2-(4-propan-2-ylphenyl)-3,4-dihydro-2H-chromen-6-yl]-1,3,2-dioxaborolane (PubChem CID 123950237) has the molecular formula C24H31BO3 and a molecular weight of 378.32 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[2-(4-propan-2-ylphenyl)-3,4-dihydro-2H-chromen-6-yl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[2-(4-propan-2-ylphenyl)-3,4-dihydro-2H-chromen-6-yl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 123950237 |
| Molecular Formula | C24H31BO3 |
| Molecular Weight | 378.32 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[2-(4-propan-2-ylphenyl)-3,4-dihydro-2H-chromen-6-yl]-1,3,2-dioxaborolane |
| SMILES | CC(C)c1ccc(C2CCc3cc(B4OC(C)(C)C(C)(C)O4)ccc3O2)cc1 |
| InChI | InChI=1S/C24H31BO3/c1-16(2)17-7-9-18(10-8-17)21-13-11-19-15-20(12-14-22(19)26-21)25-27-23(3,4)24(5,6)28-25/h7-10,12,14-16,21H,11,13H2,1-6H3 |
| InChIKey | WQLNGMQELYCVAE-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.32 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|