C23H31BO3 — CID 123913213
4,4,5,5-tetramethyl-2-[3-methyl-4-[(4-propan-2-ylphenyl)methoxy]phenyl]-1,3,2-dioxaborolane (PubChem CID 123913213) has the molecular formula C23H31BO3 and a molecular weight of 366.31 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[3-methyl-4-[(4-propan-2-ylphenyl)methoxy]phenyl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[3-methyl-4-[(4-propan-2-ylphenyl)methoxy]phenyl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 123913213 |
| Molecular Formula | C23H31BO3 |
| Molecular Weight | 366.31 g/mol |
| Exact Mass | 366.24 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[3-methyl-4-[(4-propan-2-ylphenyl)methoxy]phenyl]-1,3,2-dioxaborolane |
| SMILES | Cc1cc(B2OC(C)(C)C(C)(C)O2)ccc1OCc1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C23H31BO3/c1-16(2)19-10-8-18(9-11-19)15-25-21-13-12-20(14-17(21)3)24-26-22(4,5)23(6,7)27-24/h8-14,16H,15H2,1-7H3 |
| InChIKey | IRFDPQLHNLMEED-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.31 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|