C21H24BNO3 — CID 113249372
4-[[2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]methyl]benzonitrile (PubChem CID 113249372) has the molecular formula C21H24BNO3 and a molecular weight of 349.24 g/mol. Its IUPAC name is 4-[[2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]methyl]benzonitrile.
| Compound Name | 4-[[2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]methyl]benzonitrile |
|---|---|
| PubChem CID | 113249372 |
| Molecular Formula | C21H24BNO3 |
| Molecular Weight | 349.24 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | 4-[[2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]methyl]benzonitrile |
| SMILES | Cc1cc(B2OC(C)(C)C(C)(C)O2)ccc1OCc1ccc(C#N)cc1 |
| InChI | InChI=1S/C21H24BNO3/c1-15-12-18(22-25-20(2,3)21(4,5)26-22)10-11-19(15)24-14-17-8-6-16(13-23)7-9-17/h6-12H,14H2,1-5H3 |
| InChIKey | DQEOSQKTOHDZIU-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 51.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.24 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|