C21H26BFO5 — CID 171772584
2-[4-[(3-fluoro-4-methoxyphenyl)methoxy]-3-methoxyphenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 171772584) has the molecular formula C21H26BFO5 and a molecular weight of 388.24 g/mol. Its IUPAC name is 2-[4-[(3-fluoro-4-methoxyphenyl)methoxy]-3-methoxyphenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[4-[(3-fluoro-4-methoxyphenyl)methoxy]-3-methoxyphenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 171772584 |
| Molecular Formula | C21H26BFO5 |
| Molecular Weight | 388.24 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | 2-[4-[(3-fluoro-4-methoxyphenyl)methoxy]-3-methoxyphenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | COc1ccc(COc2ccc(B3OC(C)(C)C(C)(C)O3)cc2OC)cc1F |
| InChI | InChI=1S/C21H26BFO5/c1-20(2)21(3,4)28-22(27-20)15-8-10-18(19(12-15)25-6)26-13-14-7-9-17(24-5)16(23)11-14/h7-12H,13H2,1-6H3 |
| InChIKey | IKFLOZHKEIQSJH-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.24 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|