C14H20BFO4 — CID 145420344
[2-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl hypofluorite (PubChem CID 145420344) has the molecular formula C14H20BFO4 and a molecular weight of 282.12 g/mol. Its IUPAC name is [2-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl hypofluorite.
| Compound Name | [2-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl hypofluorite |
|---|---|
| PubChem CID | 145420344 |
| Molecular Formula | C14H20BFO4 |
| Molecular Weight | 282.12 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | [2-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl hypofluorite |
| SMILES | COc1ccc(B2OC(C)(C)C(C)(C)O2)cc1COF |
| InChI | InChI=1S/C14H20BFO4/c1-13(2)14(3,4)20-15(19-13)11-6-7-12(17-5)10(8-11)9-18-16/h6-8H,9H2,1-5H3 |
| InChIKey | YBSOVBLHFDCZHN-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.12 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|