C14H17BF3O4Si — CID 175457600
CID 175457600 (PubChem CID 175457600) has the molecular formula C14H17BF3O4Si and a molecular weight of 345.18 g/mol.
| Compound Name | CID 175457600 |
|---|---|
| PubChem CID | 175457600 |
| Molecular Formula | C14H17BF3O4Si |
| Molecular Weight | 345.18 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | — |
| SMILES | CC1(C)OB(c2ccc(OC(F)(F)F)c(CO[Si])c2)OC1(C)C |
| InChI | InChI=1S/C14H17BF3O4Si/c1-12(2)13(3,4)22-15(21-12)10-5-6-11(20-14(16,17)18)9(7-10)8-19-23/h5-7H,8H2,1-4H3 |
| InChIKey | VPLPSDWAXFHOLO-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.18 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|