C15H21BF2O4 — CID 162611613
[2-(1,1-difluoroethoxy)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanol (PubChem CID 162611613) has the molecular formula C15H21BF2O4 and a molecular weight of 314.14 g/mol. Its IUPAC name is [2-(1,1-difluoroethoxy)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanol.
| Compound Name | [2-(1,1-difluoroethoxy)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanol |
|---|---|
| PubChem CID | 162611613 |
| Molecular Formula | C15H21BF2O4 |
| Molecular Weight | 314.14 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | [2-(1,1-difluoroethoxy)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanol |
| SMILES | CC(F)(F)Oc1ccc(B2OC(C)(C)C(C)(C)O2)cc1CO |
| InChI | InChI=1S/C15H21BF2O4/c1-13(2)14(3,4)22-16(21-13)11-6-7-12(10(8-11)9-19)20-15(5,17)18/h6-8,19H,9H2,1-5H3 |
| InChIKey | IEGFWWQQTFKMOB-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.14 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|