C15H20BF3O4 — CID 67294073
2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethyl)phenoxy]ethanol (PubChem CID 67294073) has the molecular formula C15H20BF3O4 and a molecular weight of 332.13 g/mol. Its IUPAC name is 2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethyl)phenoxy]ethanol.
| Compound Name | 2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethyl)phenoxy]ethanol |
|---|---|
| PubChem CID | 67294073 |
| Molecular Formula | C15H20BF3O4 |
| Molecular Weight | 332.13 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | 2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethyl)phenoxy]ethanol |
| SMILES | CC1(C)OB(c2ccc(OCCO)c(C(F)(F)F)c2)OC1(C)C |
| InChI | InChI=1S/C15H20BF3O4/c1-13(2)14(3,4)23-16(22-13)10-5-6-12(21-8-7-20)11(9-10)15(17,18)19/h5-6,9,20H,7-8H2,1-4H3 |
| InChIKey | OHTOWVAQLOAEFC-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.13 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|