C13H18BClF3NO2 — CID 146049158
4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethyl)aniline;hydrochloride (PubChem CID 146049158) has the molecular formula C13H18BClF3NO2 and a molecular weight of 323.55 g/mol. Its IUPAC name is 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethyl)aniline;hydrochloride.
| Compound Name | 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethyl)aniline;hydrochloride |
|---|---|
| PubChem CID | 146049158 |
| Molecular Formula | C13H18BClF3NO2 |
| Molecular Weight | 323.55 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethyl)aniline;hydrochloride |
| SMILES | CC1(C)OB(c2ccc(N)c(C(F)(F)F)c2)OC1(C)C.Cl |
| InChI | InChI=1S/C13H17BF3NO2.ClH/c1-11(2)12(3,4)20-14(19-11)8-5-6-10(18)9(7-8)13(15,16)17;/h5-7H,18H2,1-4H3;1H |
| InChIKey | OJQHMUCPPJXDGH-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.55 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|