C21H31BF3NO5 — CID 150029218
[(2S)-2,4-dimethyl-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethyl)phenoxy]pentan-2-yl] carbamate (PubChem CID 150029218) has the molecular formula C21H31BF3NO5 and a molecular weight of 445.29 g/mol. Its IUPAC name is [(2S)-2,4-dimethyl-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethyl)phenoxy]pentan-2-yl] carbamate.
| Compound Name | [(2S)-2,4-dimethyl-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethyl)phenoxy]pentan-2-yl] carbamate |
|---|---|
| PubChem CID | 150029218 |
| Molecular Formula | C21H31BF3NO5 |
| Molecular Weight | 445.29 g/mol |
| Exact Mass | 445.22 |
| IUPAC Name | [(2S)-2,4-dimethyl-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethyl)phenoxy]pentan-2-yl] carbamate |
| SMILES | CC(C)C[C@@](C)(COc1ccc(B2OC(C)(C)C(C)(C)O2)cc1C(F)(F)F)OC(N)=O |
| InChI | InChI=1S/C21H31BF3NO5/c1-13(2)11-20(7,29-17(26)27)12-28-16-9-8-14(10-15(16)21(23,24)25)22-30-18(3,4)19(5,6)31-22/h8-10,13H,11-12H2,1-7H3,(H2,26,27)/t20-/m0/s1 |
| InChIKey | DGWZSUZGKWUKCH-FQEVSTJZSA-N |
| XLogP | 4.28 |
| TPSA | 80.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.29 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|