C21H31BN2O5 — CID 154466778
[1-[2-cyano-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]-2,4-dimethylpentan-2-yl]carbamic acid (PubChem CID 154466778) has the molecular formula C21H31BN2O5 and a molecular weight of 402.30 g/mol. Its IUPAC name is [1-[2-cyano-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]-2,4-dimethylpentan-2-yl]carbamic acid.
| Compound Name | [1-[2-cyano-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]-2,4-dimethylpentan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 154466778 |
| Molecular Formula | C21H31BN2O5 |
| Molecular Weight | 402.30 g/mol |
| Exact Mass | 402.23 |
| IUPAC Name | [1-[2-cyano-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]-2,4-dimethylpentan-2-yl]carbamic acid |
| SMILES | CC(C)CC(C)(COc1ccc(B2OC(C)(C)C(C)(C)O2)cc1C#N)NC(=O)O |
| InChI | InChI=1S/C21H31BN2O5/c1-14(2)11-21(7,24-18(25)26)13-27-17-9-8-16(10-15(17)12-23)22-28-19(3,4)20(5,6)29-22/h8-10,14,24H,11,13H2,1-7H3,(H,25,26) |
| InChIKey | GUXRQVXQVYHNRN-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 100.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.30 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|