C21H28N2O3 — CID 118419749
[1-[4-(3-aminophenyl)-2-methylphenoxy]-2,4-dimethylpentan-2-yl]carbamic acid (PubChem CID 118419749) has the molecular formula C21H28N2O3 and a molecular weight of 356.47 g/mol. Its IUPAC name is [1-[4-(3-aminophenyl)-2-methylphenoxy]-2,4-dimethylpentan-2-yl]carbamic acid.
| Compound Name | [1-[4-(3-aminophenyl)-2-methylphenoxy]-2,4-dimethylpentan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 118419749 |
| Molecular Formula | C21H28N2O3 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.21 |
| IUPAC Name | [1-[4-(3-aminophenyl)-2-methylphenoxy]-2,4-dimethylpentan-2-yl]carbamic acid |
| SMILES | Cc1cc(-c2cccc(N)c2)ccc1OCC(C)(CC(C)C)NC(=O)O |
| InChI | InChI=1S/C21H28N2O3/c1-14(2)12-21(4,23-20(24)25)13-26-19-9-8-17(10-15(19)3)16-6-5-7-18(22)11-16/h5-11,14,23H,12-13,22H2,1-4H3,(H,24,25) |
| InChIKey | AWGTUAUYUPXFHA-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|