C14H20BrFN2O3 — CID 135282359
[1-[[6-bromo-2-(fluoromethyl)-3-pyridinyl]oxy]-2,4-dimethylpentan-2-yl]carbamic acid (PubChem CID 135282359) has the molecular formula C14H20BrFN2O3 and a molecular weight of 363.23 g/mol. Its IUPAC name is [1-[[6-bromo-2-(fluoromethyl)-3-pyridinyl]oxy]-2,4-dimethylpentan-2-yl]carbamic acid.
| Compound Name | [1-[[6-bromo-2-(fluoromethyl)-3-pyridinyl]oxy]-2,4-dimethylpentan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 135282359 |
| Molecular Formula | C14H20BrFN2O3 |
| Molecular Weight | 363.23 g/mol |
| Exact Mass | 362.06 |
| IUPAC Name | [1-[[6-bromo-2-(fluoromethyl)-3-pyridinyl]oxy]-2,4-dimethylpentan-2-yl]carbamic acid |
| SMILES | CC(C)CC(C)(COc1ccc(Br)nc1CF)NC(=O)O |
| InChI | InChI=1S/C14H20BrFN2O3/c1-9(2)6-14(3,18-13(19)20)8-21-11-4-5-12(15)17-10(11)7-16/h4-5,9,18H,6-8H2,1-3H3,(H,19,20) |
| InChIKey | JRPGSTNHWPHWHN-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.23 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|