C20H31BO4 — CID 161196453
1-[2-ethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]-4-methylpentan-2-one (PubChem CID 161196453) has the molecular formula C20H31BO4 and a molecular weight of 346.28 g/mol. Its IUPAC name is 1-[2-ethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]-4-methylpentan-2-one.
| Compound Name | 1-[2-ethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]-4-methylpentan-2-one |
|---|---|
| PubChem CID | 161196453 |
| Molecular Formula | C20H31BO4 |
| Molecular Weight | 346.28 g/mol |
| Exact Mass | 346.23 |
| IUPAC Name | 1-[2-ethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]-4-methylpentan-2-one |
| SMILES | CCc1cc(B2OC(C)(C)C(C)(C)O2)ccc1OCC(=O)CC(C)C |
| InChI | InChI=1S/C20H31BO4/c1-8-15-12-16(21-24-19(4,5)20(6,7)25-21)9-10-18(15)23-13-17(22)11-14(2)3/h9-10,12,14H,8,11,13H2,1-7H3 |
| InChIKey | UUKFTEYHVJAREB-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.28 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|