C18H25BF2O4 — CID 158027862
1-[2,6-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]-4-methylpentan-2-one (PubChem CID 158027862) has the molecular formula C18H25BF2O4 and a molecular weight of 354.20 g/mol. Its IUPAC name is 1-[2,6-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]-4-methylpentan-2-one.
| Compound Name | 1-[2,6-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]-4-methylpentan-2-one |
|---|---|
| PubChem CID | 158027862 |
| Molecular Formula | C18H25BF2O4 |
| Molecular Weight | 354.20 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | 1-[2,6-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]-4-methylpentan-2-one |
| SMILES | CC(C)CC(=O)COc1c(F)cc(B2OC(C)(C)C(C)(C)O2)cc1F |
| InChI | InChI=1S/C18H25BF2O4/c1-11(2)7-13(22)10-23-16-14(20)8-12(9-15(16)21)19-24-17(3,4)18(5,6)25-19/h8-9,11H,7,10H2,1-6H3 |
| InChIKey | FGUVPSWCTHLBRK-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.20 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|