C20H29BF2O5 — CID 140722311
ethyl 4-[2,6-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]-2-ethylbutanoate (PubChem CID 140722311) has the molecular formula C20H29BF2O5 and a molecular weight of 398.26 g/mol. Its IUPAC name is ethyl 4-[2,6-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]-2-ethylbutanoate.
| Compound Name | ethyl 4-[2,6-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]-2-ethylbutanoate |
|---|---|
| PubChem CID | 140722311 |
| Molecular Formula | C20H29BF2O5 |
| Molecular Weight | 398.26 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | ethyl 4-[2,6-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]-2-ethylbutanoate |
| SMILES | CCOC(=O)C(CC)CCOc1c(F)cc(B2OC(C)(C)C(C)(C)O2)cc1F |
| InChI | InChI=1S/C20H29BF2O5/c1-7-13(18(24)25-8-2)9-10-26-17-15(22)11-14(12-16(17)23)21-27-19(3,4)20(5,6)28-21/h11-13H,7-10H2,1-6H3 |
| InChIKey | ORKFNTCLRJAMFW-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.26 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|