C18H24BF4NO4 — CID 156728204
ethyl (3S)-3-amino-3-[2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(trifluoromethyl)phenyl]propanoate (PubChem CID 156728204) has the molecular formula C18H24BF4NO4 and a molecular weight of 405.20 g/mol. Its IUPAC name is ethyl (3S)-3-amino-3-[2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(trifluoromethyl)phenyl]propanoate.
| Compound Name | ethyl (3S)-3-amino-3-[2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(trifluoromethyl)phenyl]propanoate |
|---|---|
| PubChem CID | 156728204 |
| Molecular Formula | C18H24BF4NO4 |
| Molecular Weight | 405.20 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | ethyl (3S)-3-amino-3-[2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(trifluoromethyl)phenyl]propanoate |
| SMILES | CCOC(=O)C[C@H](N)c1cc(B2OC(C)(C)C(C)(C)O2)cc(C(F)(F)F)c1F |
| InChI | InChI=1S/C18H24BF4NO4/c1-6-26-14(25)9-13(24)11-7-10(8-12(15(11)20)18(21,22)23)19-27-16(2,3)17(4,5)28-19/h7-8,13H,6,9,24H2,1-5H3/t13-/m0/s1 |
| InChIKey | YHRDOIGNQDVPCK-ZDUSSCGKSA-N |
| XLogP | 3.10 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.20 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|