C23H35BFNO7 — CID 174014181
ethyl (3R)-3-[2-fluoro-3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (PubChem CID 174014181) has the molecular formula C23H35BFNO7 and a molecular weight of 467.34 g/mol. Its IUPAC name is ethyl (3R)-3-[2-fluoro-3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate.
| Compound Name | ethyl (3R)-3-[2-fluoro-3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
|---|---|
| PubChem CID | 174014181 |
| Molecular Formula | C23H35BFNO7 |
| Molecular Weight | 467.34 g/mol |
| Exact Mass | 467.25 |
| IUPAC Name | ethyl (3R)-3-[2-fluoro-3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| SMILES | CCOC(=O)C[C@](O)(NC(=O)OC(C)(C)C)c1cc(B2OC(C)(C)C(C)(C)O2)cc(C)c1F |
| InChI | InChI=1S/C23H35BFNO7/c1-10-30-17(27)13-23(29,26-19(28)31-20(3,4)5)16-12-15(11-14(2)18(16)25)24-32-21(6,7)22(8,9)33-24/h11-12,29H,10,13H2,1-9H3,(H,26,28)/t23-/m1/s1 |
| InChIKey | HUQWVFKQKKCGDZ-HSZRJFAPSA-N |
| XLogP | 3.06 |
| TPSA | 103.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.34 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|