C23H38BNO5 — CID 123485236
tert-butyl N-[2-methyl-1-[2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]butyl]carbamate (PubChem CID 123485236) has the molecular formula C23H38BNO5 and a molecular weight of 419.37 g/mol. Its IUPAC name is tert-butyl N-[2-methyl-1-[2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]butyl]carbamate.
| Compound Name | tert-butyl N-[2-methyl-1-[2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]butyl]carbamate |
|---|---|
| PubChem CID | 123485236 |
| Molecular Formula | C23H38BNO5 |
| Molecular Weight | 419.37 g/mol |
| Exact Mass | 419.28 |
| IUPAC Name | tert-butyl N-[2-methyl-1-[2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]butyl]carbamate |
| SMILES | CCC(C)C(NC(=O)OC(C)(C)C)Oc1cc(B2OC(C)(C)C(C)(C)O2)ccc1C |
| InChI | InChI=1S/C23H38BNO5/c1-11-15(2)19(25-20(26)28-21(4,5)6)27-18-14-17(13-12-16(18)3)24-29-22(7,8)23(9,10)30-24/h12-15,19H,11H2,1-10H3,(H,25,26) |
| InChIKey | FXRMVXUPMKWLOE-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.37 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|