C21H32BNO6 — CID 67536316
3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]butanoic acid (PubChem CID 67536316) has the molecular formula C21H32BNO6 and a molecular weight of 405.30 g/mol. Its IUPAC name is 3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]butanoic acid.
| Compound Name | 3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]butanoic acid |
|---|---|
| PubChem CID | 67536316 |
| Molecular Formula | C21H32BNO6 |
| Molecular Weight | 405.30 g/mol |
| Exact Mass | 405.23 |
| IUPAC Name | 3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]butanoic acid |
| SMILES | CC(C)(C)OC(=O)NC(CC(=O)O)Cc1ccc(B2OC(C)(C)C(C)(C)O2)cc1 |
| InChI | InChI=1S/C21H32BNO6/c1-19(2,3)27-18(26)23-16(13-17(24)25)12-14-8-10-15(11-9-14)22-28-20(4,5)21(6,7)29-22/h8-11,16H,12-13H2,1-7H3,(H,23,26)(H,24,25) |
| InChIKey | UTHLCOPRRRGVBJ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.30 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|