C24H35BF2N2O5 — CID 164946118
tert-butyl N-[(2S)-1-[(3,3-difluorocyclobutyl)amino]-1-oxo-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propan-2-yl]carbamate (PubChem CID 164946118) has the molecular formula C24H35BF2N2O5 and a molecular weight of 480.36 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-[(3,3-difluorocyclobutyl)amino]-1-oxo-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-[(3,3-difluorocyclobutyl)amino]-1-oxo-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propan-2-yl]carbamate |
|---|---|
| PubChem CID | 164946118 |
| Molecular Formula | C24H35BF2N2O5 |
| Molecular Weight | 480.36 g/mol |
| Exact Mass | 480.26 |
| IUPAC Name | tert-butyl N-[(2S)-1-[(3,3-difluorocyclobutyl)amino]-1-oxo-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](Cc1ccc(B2OC(C)(C)C(C)(C)O2)cc1)C(=O)NC1CC(F)(F)C1 |
| InChI | InChI=1S/C24H35BF2N2O5/c1-21(2,3)32-20(31)29-18(19(30)28-17-13-24(26,27)14-17)12-15-8-10-16(11-9-15)25-33-22(4,5)23(6,7)34-25/h8-11,17-18H,12-14H2,1-7H3,(H,28,30)(H,29,31)/t18-/m0/s1 |
| InChIKey | XHWCMKYDVNYXEV-SFHVURJKSA-N |
| XLogP | 3.34 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.36 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|