C26H41BN2O4 — CID 154651865
tert-butyl N-[1-[1-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]cyclopropyl]piperidin-4-yl]carbamate (PubChem CID 154651865) has the molecular formula C26H41BN2O4 and a molecular weight of 456.44 g/mol. Its IUPAC name is tert-butyl N-[1-[1-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]cyclopropyl]piperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-[1-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]cyclopropyl]piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 154651865 |
| Molecular Formula | C26H41BN2O4 |
| Molecular Weight | 456.44 g/mol |
| Exact Mass | 456.32 |
| IUPAC Name | tert-butyl N-[1-[1-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]cyclopropyl]piperidin-4-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCN(C2(Cc3ccc(B4OC(C)(C)C(C)(C)O4)cc3)CC2)CC1 |
| InChI | InChI=1S/C26H41BN2O4/c1-23(2,3)31-22(30)28-21-12-16-29(17-13-21)26(14-15-26)18-19-8-10-20(11-9-19)27-32-24(4,5)25(6,7)33-27/h8-11,21H,12-18H2,1-7H3,(H,28,30) |
| InChIKey | KULZFGJOAGPKHR-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.44 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|