C19H30BN3O4 — CID 175419835
tert-butyl N-[1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]azetidin-3-yl]carbamate (PubChem CID 175419835) has the molecular formula C19H30BN3O4 and a molecular weight of 375.28 g/mol. Its IUPAC name is tert-butyl N-[1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]azetidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]azetidin-3-yl]carbamate |
|---|---|
| PubChem CID | 175419835 |
| Molecular Formula | C19H30BN3O4 |
| Molecular Weight | 375.28 g/mol |
| Exact Mass | 375.23 |
| IUPAC Name | tert-butyl N-[1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]azetidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CN(c2ccc(B3OC(C)(C)C(C)(C)O3)cn2)C1 |
| InChI | InChI=1S/C19H30BN3O4/c1-17(2,3)25-16(24)22-14-11-23(12-14)15-9-8-13(10-21-15)20-26-18(4,5)19(6,7)27-20/h8-10,14H,11-12H2,1-7H3,(H,22,24) |
| InChIKey | YUZSOTNMXVPLLY-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 72.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.28 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|