C24H32BN3O4 — CID 66863847
tert-butyl 4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]-2,3-dihydroquinoxaline-1-carboxylate (PubChem CID 66863847) has the molecular formula C24H32BN3O4 and a molecular weight of 437.35 g/mol. Its IUPAC name is tert-butyl 4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]-2,3-dihydroquinoxaline-1-carboxylate.
| Compound Name | tert-butyl 4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]-2,3-dihydroquinoxaline-1-carboxylate |
|---|---|
| PubChem CID | 66863847 |
| Molecular Formula | C24H32BN3O4 |
| Molecular Weight | 437.35 g/mol |
| Exact Mass | 437.25 |
| IUPAC Name | tert-butyl 4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]-2,3-dihydroquinoxaline-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ccc(B3OC(C)(C)C(C)(C)O3)cn2)c2ccccc21 |
| InChI | InChI=1S/C24H32BN3O4/c1-22(2,3)30-21(29)28-15-14-27(18-10-8-9-11-19(18)28)20-13-12-17(16-26-20)25-31-23(4,5)24(6,7)32-25/h8-13,16H,14-15H2,1-7H3 |
| InChIKey | FPEMGFLDGWHARB-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 64.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.35 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|