C20H35BN2O6 — CID 172643955
ditert-butyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydropyrazine-1,4-dicarboxylate (PubChem CID 172643955) has the molecular formula C20H35BN2O6 and a molecular weight of 410.32 g/mol. Its IUPAC name is ditert-butyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydropyrazine-1,4-dicarboxylate.
| Compound Name | ditert-butyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydropyrazine-1,4-dicarboxylate |
|---|---|
| PubChem CID | 172643955 |
| Molecular Formula | C20H35BN2O6 |
| Molecular Weight | 410.32 g/mol |
| Exact Mass | 410.26 |
| IUPAC Name | ditert-butyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydropyrazine-1,4-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)N1C=C(B2OC(C)(C)C(C)(C)O2)N(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C20H35BN2O6/c1-17(2,3)26-15(24)22-11-12-23(16(25)27-18(4,5)6)14(13-22)21-28-19(7,8)20(9,10)29-21/h13H,11-12H2,1-10H3 |
| InChIKey | ZMBIYWSPNKTGCL-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.32 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|