C15H24BNO5 — CID 138110424
tert-butyl 5-oxo-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-pyrrole-1-carboxylate (PubChem CID 138110424) has the molecular formula C15H24BNO5 and a molecular weight of 309.17 g/mol. Its IUPAC name is tert-butyl 5-oxo-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-pyrrole-1-carboxylate.
| Compound Name | tert-butyl 5-oxo-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-pyrrole-1-carboxylate |
|---|---|
| PubChem CID | 138110424 |
| Molecular Formula | C15H24BNO5 |
| Molecular Weight | 309.17 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | tert-butyl 5-oxo-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-pyrrole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(B2OC(C)(C)C(C)(C)O2)=CC1=O |
| InChI | InChI=1S/C15H24BNO5/c1-13(2,3)20-12(19)17-9-10(8-11(17)18)16-21-14(4,5)15(6,7)22-16/h8H,9H2,1-7H3 |
| InChIKey | GNOQPPXBYXLJDV-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.17 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|