C21H36BNO6 — CID 155672791
ditert-butyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,6-dihydro-2H-pyridine-1,2-dicarboxylate (PubChem CID 155672791) has the molecular formula C21H36BNO6 and a molecular weight of 409.33 g/mol. Its IUPAC name is ditert-butyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,6-dihydro-2H-pyridine-1,2-dicarboxylate.
| Compound Name | ditert-butyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,6-dihydro-2H-pyridine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 155672791 |
| Molecular Formula | C21H36BNO6 |
| Molecular Weight | 409.33 g/mol |
| Exact Mass | 409.26 |
| IUPAC Name | ditert-butyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,6-dihydro-2H-pyridine-1,2-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)C1CC(B2OC(C)(C)C(C)(C)O2)=CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H36BNO6/c1-18(2,3)26-16(24)15-13-14(22-28-20(7,8)21(9,10)29-22)11-12-23(15)17(25)27-19(4,5)6/h11,15H,12-13H2,1-10H3 |
| InChIKey | QLIQSPODBIAQNQ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.33 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|