C23H33BF3NO4 — CID 140811758
tert-butyl 4-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 140811758) has the molecular formula C23H33BF3NO4 and a molecular weight of 455.33 g/mol. Its IUPAC name is tert-butyl 4-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 140811758 |
| Molecular Formula | C23H33BF3NO4 |
| Molecular Weight | 455.33 g/mol |
| Exact Mass | 455.25 |
| IUPAC Name | tert-butyl 4-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC=C(C2CC(C(F)(F)F)=CC=C2B2OC(C)(C)C(C)(C)O2)CC1 |
| InChI | InChI=1S/C23H33BF3NO4/c1-20(2,3)30-19(29)28-12-10-15(11-13-28)17-14-16(23(25,26)27)8-9-18(17)24-31-21(4,5)22(6,7)32-24/h8-10,17H,11-14H2,1-7H3 |
| InChIKey | LPUPFXCWOJDNHR-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.33 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|