C21H37BN2O6S — CID 176620707
tert-butyl 4-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,6-dihydro-2H-pyridin-1-yl]sulfonyl]piperidine-1-carboxylate (PubChem CID 176620707) has the molecular formula C21H37BN2O6S and a molecular weight of 456.41 g/mol. Its IUPAC name is tert-butyl 4-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,6-dihydro-2H-pyridin-1-yl]sulfonyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,6-dihydro-2H-pyridin-1-yl]sulfonyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 176620707 |
| Molecular Formula | C21H37BN2O6S |
| Molecular Weight | 456.41 g/mol |
| Exact Mass | 456.25 |
| IUPAC Name | tert-butyl 4-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,6-dihydro-2H-pyridin-1-yl]sulfonyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(S(=O)(=O)N2CC=C(B3OC(C)(C)C(C)(C)O3)CC2)CC1 |
| InChI | InChI=1S/C21H37BN2O6S/c1-19(2,3)28-18(25)23-12-10-17(11-13-23)31(26,27)24-14-8-16(9-15-24)22-29-20(4,5)21(6,7)30-22/h8,17H,9-15H2,1-7H3 |
| InChIKey | CYSYXSYVWITRSO-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.41 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|