C23H38BBrN2O4S — CID 159411259
2-bromoaniline;tert-butyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,6-dihydro-2H-pyridine-1-carboxylate;methanethiol (PubChem CID 159411259) has the molecular formula C23H38BBrN2O4S and a molecular weight of 529.35 g/mol. Its IUPAC name is 2-bromoaniline;tert-butyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,6-dihydro-2H-pyridine-1-carboxylate;methanethiol.
| Compound Name | 2-bromoaniline;tert-butyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,6-dihydro-2H-pyridine-1-carboxylate;methanethiol |
|---|---|
| PubChem CID | 159411259 |
| Molecular Formula | C23H38BBrN2O4S |
| Molecular Weight | 529.35 g/mol |
| Exact Mass | 528.18 |
| IUPAC Name | 2-bromoaniline;tert-butyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,6-dihydro-2H-pyridine-1-carboxylate;methanethiol |
| SMILES | CC(C)(C)OC(=O)N1CC=C(B2OC(C)(C)C(C)(C)O2)CC1.CS.Nc1ccccc1Br |
| InChI | InChI=1S/C16H28BNO4.C6H6BrN.CH4S/c1-14(2,3)20-13(19)18-10-8-12(9-11-18)17-21-15(4,5)16(6,7)22-17;7-5-3-1-2-4-6(5)8;1-2/h8H,9-11H2,1-7H3;1-4H,8H2;2H,1H3 |
| InChIKey | LOPLCBIOUXIKPO-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 74.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.35 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|