C36H50BBrN2O8 — CID 158948768
3-bromophenol;tert-butyl 3-(3-hydroxyphenyl)-2,5-dihydropyrrole-1-carboxylate;tert-butyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,5-dihydropyrrole-1-carboxylate (PubChem CID 158948768) has the molecular formula C36H50BBrN2O8 and a molecular weight of 729.52 g/mol. Its IUPAC name is 3-bromophenol;tert-butyl 3-(3-hydroxyphenyl)-2,5-dihydropyrrole-1-carboxylate;tert-butyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,5-dihydropyrrole-1-carboxylate.
| Compound Name | 3-bromophenol;tert-butyl 3-(3-hydroxyphenyl)-2,5-dihydropyrrole-1-carboxylate;tert-butyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,5-dihydropyrrole-1-carboxylate |
|---|---|
| PubChem CID | 158948768 |
| Molecular Formula | C36H50BBrN2O8 |
| Molecular Weight | 729.52 g/mol |
| Exact Mass | 728.28 |
| IUPAC Name | 3-bromophenol;tert-butyl 3-(3-hydroxyphenyl)-2,5-dihydropyrrole-1-carboxylate;tert-butyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,5-dihydropyrrole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC=C(B2OC(C)(C)C(C)(C)O2)C1.CC(C)(C)OC(=O)N1CC=C(c2cccc(O)c2)C1.Oc1cccc(Br)c1 |
| InChI | InChI=1S/C15H26BNO4.C15H19NO3.C6H5BrO/c1-13(2,3)19-12(18)17-9-8-11(10-17)16-20-14(4,5)15(6,7)21-16;1-15(2,3)19-14(18)16-8-7-12(10-16)11-5-4-6-13(17)9-11;7-5-2-1-3-6(8)4-5/h8H,9-10H2,1-7H3;4-7,9,17H,8,10H2,1-3H3;1-4,8H |
| InChIKey | JLDSBMZTXBKJLB-UHFFFAOYSA-N |
| XLogP | 7.98 |
| TPSA | 118.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.52 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|