C18H32BNO3 — CID 177140554
tert-butyl 4-[(3R)-3-ethyl-4,5,5-trimethyloxaborolan-2-yl]-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 177140554) has the molecular formula C18H32BNO3 and a molecular weight of 321.27 g/mol. Its IUPAC name is tert-butyl 4-[(3R)-3-ethyl-4,5,5-trimethyloxaborolan-2-yl]-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | tert-butyl 4-[(3R)-3-ethyl-4,5,5-trimethyloxaborolan-2-yl]-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 177140554 |
| Molecular Formula | C18H32BNO3 |
| Molecular Weight | 321.27 g/mol |
| Exact Mass | 321.25 |
| IUPAC Name | tert-butyl 4-[(3R)-3-ethyl-4,5,5-trimethyloxaborolan-2-yl]-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | CC[C@H]1B(C2=CCN(C(=O)OC(C)(C)C)CC2)OC(C)(C)C1C |
| InChI | InChI=1S/C18H32BNO3/c1-8-15-13(2)18(6,7)23-19(15)14-9-11-20(12-10-14)16(21)22-17(3,4)5/h9,13,15H,8,10-12H2,1-7H3/t13?,15-/m1/s1 |
| InChIKey | OYDQJXMCFCJLHF-AWKYBWMHSA-N |
| XLogP | 4.31 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.27 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|