C12H21NO2S — CID 117205631
tert-butyl 4-(2-sulfanylethyl)-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 117205631) has the molecular formula C12H21NO2S and a molecular weight of 243.37 g/mol. Its IUPAC name is tert-butyl 4-(2-sulfanylethyl)-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | tert-butyl 4-(2-sulfanylethyl)-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 117205631 |
| Molecular Formula | C12H21NO2S |
| Molecular Weight | 243.37 g/mol |
| Exact Mass | 243.13 |
| IUPAC Name | tert-butyl 4-(2-sulfanylethyl)-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC=C(CCS)CC1 |
| InChI | InChI=1S/C12H21NO2S/c1-12(2,3)15-11(14)13-7-4-10(5-8-13)6-9-16/h4,16H,5-9H2,1-3H3 |
| InChIKey | DFNIRAHVOLGLNU-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 29.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.37 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|