C12H22NO3P — CID 154727855
tert-butyl 4-dimethylphosphoryl-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 154727855) has the molecular formula C12H22NO3P and a molecular weight of 259.29 g/mol. Its IUPAC name is tert-butyl 4-dimethylphosphoryl-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | tert-butyl 4-dimethylphosphoryl-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 154727855 |
| Molecular Formula | C12H22NO3P |
| Molecular Weight | 259.29 g/mol |
| Exact Mass | 259.13 |
| IUPAC Name | tert-butyl 4-dimethylphosphoryl-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC=C(P(C)(C)=O)CC1 |
| InChI | InChI=1S/C12H22NO3P/c1-12(2,3)16-11(14)13-8-6-10(7-9-13)17(4,5)15/h6H,7-9H2,1-5H3 |
| InChIKey | JTPVHRCOCQRDTH-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.29 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|