C11H19NO5S — CID 58374576
tert-butyl 4-methylsulfonyloxy-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 58374576) has the molecular formula C11H19NO5S and a molecular weight of 277.34 g/mol. Its IUPAC name is tert-butyl 4-methylsulfonyloxy-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | tert-butyl 4-methylsulfonyloxy-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 58374576 |
| Molecular Formula | C11H19NO5S |
| Molecular Weight | 277.34 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | tert-butyl 4-methylsulfonyloxy-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC=C(OS(C)(=O)=O)CC1 |
| InChI | InChI=1S/C11H19NO5S/c1-11(2,3)16-10(13)12-7-5-9(6-8-12)17-18(4,14)15/h5H,6-8H2,1-4H3 |
| InChIKey | YAYOMXCGTZXGCW-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.34 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|