C13H22N2O3 — CID 173482084
tert-butyl 4-[[(E)-1-hydroxyprop-1-en-2-yl]amino]-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 173482084) has the molecular formula C13H22N2O3 and a molecular weight of 254.33 g/mol. Its IUPAC name is tert-butyl 4-[[(E)-1-hydroxyprop-1-en-2-yl]amino]-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | tert-butyl 4-[[(E)-1-hydroxyprop-1-en-2-yl]amino]-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 173482084 |
| Molecular Formula | C13H22N2O3 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.16 |
| IUPAC Name | tert-butyl 4-[[(E)-1-hydroxyprop-1-en-2-yl]amino]-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | C/C(=C\O)NC1=CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C13H22N2O3/c1-10(9-16)14-11-5-7-15(8-6-11)12(17)18-13(2,3)4/h5,9,14,16H,6-8H2,1-4H3/b10-9+ |
| InChIKey | FATGWSZKNBKGNE-MDZDMXLPSA-N |
| XLogP | 2.52 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|