C18H28BNO4S — CID 172908159
tert-butyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5,7-dihydro-4H-thieno[2,3-c]pyridine-6-carboxylate (PubChem CID 172908159) has the molecular formula C18H28BNO4S and a molecular weight of 365.30 g/mol. Its IUPAC name is tert-butyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5,7-dihydro-4H-thieno[2,3-c]pyridine-6-carboxylate.
| Compound Name | tert-butyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5,7-dihydro-4H-thieno[2,3-c]pyridine-6-carboxylate |
|---|---|
| PubChem CID | 172908159 |
| Molecular Formula | C18H28BNO4S |
| Molecular Weight | 365.30 g/mol |
| Exact Mass | 365.18 |
| IUPAC Name | tert-butyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5,7-dihydro-4H-thieno[2,3-c]pyridine-6-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCc2c(B3OC(C)(C)C(C)(C)O3)csc2C1 |
| InChI | InChI=1S/C18H28BNO4S/c1-16(2,3)22-15(21)20-9-8-12-13(11-25-14(12)10-20)19-23-17(4,5)18(6,7)24-19/h11H,8-10H2,1-7H3 |
| InChIKey | SGIYDQXHJSHORM-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.30 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|