C19H37BN2O4S2 — CID 159418759
tert-butyl (1S,8aS)-1-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4,6,8a-tetrahydro-1H-pyrrolo[1,2-a]pyrazine-2-carboxylate;sulfane (PubChem CID 159418759) has the molecular formula C19H37BN2O4S2 and a molecular weight of 432.46 g/mol. Its IUPAC name is tert-butyl (1S,8aS)-1-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4,6,8a-tetrahydro-1H-pyrrolo[1,2-a]pyrazine-2-carboxylate;sulfane.
| Compound Name | tert-butyl (1S,8aS)-1-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4,6,8a-tetrahydro-1H-pyrrolo[1,2-a]pyrazine-2-carboxylate;sulfane |
|---|---|
| PubChem CID | 159418759 |
| Molecular Formula | C19H37BN2O4S2 |
| Molecular Weight | 432.46 g/mol |
| Exact Mass | 432.23 |
| IUPAC Name | tert-butyl (1S,8aS)-1-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4,6,8a-tetrahydro-1H-pyrrolo[1,2-a]pyrazine-2-carboxylate;sulfane |
| SMILES | C[C@H]1[C@@H]2C=C(B3OC(C)(C)C(C)(C)O3)CN2CCN1C(=O)OC(C)(C)C.S.S |
| InChI | InChI=1S/C19H33BN2O4.2H2S/c1-13-15-11-14(20-25-18(5,6)19(7,8)26-20)12-21(15)9-10-22(13)16(23)24-17(2,3)4;;/h11,13,15H,9-10,12H2,1-8H3;2*1H2/t13-,15-;;/m0../s1 |
| InChIKey | LPMNNIHUFXXRJK-USQKXAEFSA-N |
| XLogP | 3.09 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.46 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|