C23H36BNO4 — CID 169114063
tert-butyl 5-methyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperidine-1-carboxylate (PubChem CID 169114063) has the molecular formula C23H36BNO4 and a molecular weight of 401.36 g/mol. Its IUPAC name is tert-butyl 5-methyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 5-methyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 169114063 |
| Molecular Formula | C23H36BNO4 |
| Molecular Weight | 401.36 g/mol |
| Exact Mass | 401.27 |
| IUPAC Name | tert-butyl 5-methyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperidine-1-carboxylate |
| SMILES | CC1CCC(c2ccc(B3OC(C)(C)C(C)(C)O3)cc2)N(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C23H36BNO4/c1-16-9-14-19(25(15-16)20(26)27-21(2,3)4)17-10-12-18(13-11-17)24-28-22(5,6)23(7,8)29-24/h10-13,16,19H,9,14-15H2,1-8H3 |
| InChIKey | PDSPJBJZGLOMSY-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.36 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|