C26H39BFNO4 — CID 58294261
tert-butyl (2S,4S)-4-fluoro-2-[3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclopentyl]pyrrolidine-1-carboxylate (PubChem CID 58294261) has the molecular formula C26H39BFNO4 and a molecular weight of 459.41 g/mol. Its IUPAC name is tert-butyl (2S,4S)-4-fluoro-2-[3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclopentyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,4S)-4-fluoro-2-[3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclopentyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 58294261 |
| Molecular Formula | C26H39BFNO4 |
| Molecular Weight | 459.41 g/mol |
| Exact Mass | 459.30 |
| IUPAC Name | tert-butyl (2S,4S)-4-fluoro-2-[3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclopentyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H](F)C[C@H]1C1CCC(c2ccc(B3OC(C)(C)C(C)(C)O3)cc2)C1 |
| InChI | InChI=1S/C26H39BFNO4/c1-24(2,3)31-23(30)29-16-21(28)15-22(29)19-9-8-18(14-19)17-10-12-20(13-11-17)27-32-25(4,5)26(6,7)33-27/h10-13,18-19,21-22H,8-9,14-16H2,1-7H3/t18?,19?,21-,22-/m0/s1 |
| InChIKey | WEENJEXMIPWAGE-NZUHHQEFSA-N |
| XLogP | 5.22 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.41 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|