C19H32BNO4 — CID 124636718
tert-butyl (1R,5R)-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-azabicyclo[3.3.1]non-6-ene-3-carboxylate (PubChem CID 124636718) has the molecular formula C19H32BNO4 and a molecular weight of 349.28 g/mol. Its IUPAC name is tert-butyl (1R,5R)-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-azabicyclo[3.3.1]non-6-ene-3-carboxylate.
| Compound Name | tert-butyl (1R,5R)-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-azabicyclo[3.3.1]non-6-ene-3-carboxylate |
|---|---|
| PubChem CID | 124636718 |
| Molecular Formula | C19H32BNO4 |
| Molecular Weight | 349.28 g/mol |
| Exact Mass | 349.24 |
| IUPAC Name | tert-butyl (1R,5R)-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-azabicyclo[3.3.1]non-6-ene-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@H]2C=C(B3OC(C)(C)C(C)(C)O3)C[C@@H](C2)C1 |
| InChI | InChI=1S/C19H32BNO4/c1-17(2,3)23-16(22)21-11-13-8-14(12-21)10-15(9-13)20-24-18(4,5)19(6,7)25-20/h9,13-14H,8,10-12H2,1-7H3/t13-,14-/m1/s1 |
| InChIKey | OMJAXKOGIBCDKU-ZIAGYGMSSA-N |
| XLogP | 3.82 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.28 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|