C19H28BFN2O5 — CID 146676052
tert-butyl N-[[2-[2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetyl]amino]carbamate (PubChem CID 146676052) has the molecular formula C19H28BFN2O5 and a molecular weight of 394.25 g/mol. Its IUPAC name is tert-butyl N-[[2-[2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetyl]amino]carbamate.
| Compound Name | tert-butyl N-[[2-[2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetyl]amino]carbamate |
|---|---|
| PubChem CID | 146676052 |
| Molecular Formula | C19H28BFN2O5 |
| Molecular Weight | 394.25 g/mol |
| Exact Mass | 394.21 |
| IUPAC Name | tert-butyl N-[[2-[2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetyl]amino]carbamate |
| SMILES | CC(C)(C)OC(=O)NNC(=O)Cc1cc(B2OC(C)(C)C(C)(C)O2)ccc1F |
| InChI | InChI=1S/C19H28BFN2O5/c1-17(2,3)26-16(25)23-22-15(24)11-12-10-13(8-9-14(12)21)20-27-18(4,5)19(6,7)28-20/h8-10H,11H2,1-7H3,(H,22,24)(H,23,25) |
| InChIKey | KCCMHHRUDYAVJR-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.25 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|