C18H29BN2O5 — CID 130115059
tert-butyl N-[[2-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]methyl]carbamate (PubChem CID 130115059) has the molecular formula C18H29BN2O5 and a molecular weight of 364.25 g/mol. Its IUPAC name is tert-butyl N-[[2-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[2-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]methyl]carbamate |
|---|---|
| PubChem CID | 130115059 |
| Molecular Formula | C18H29BN2O5 |
| Molecular Weight | 364.25 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | tert-butyl N-[[2-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]methyl]carbamate |
| SMILES | COc1ncc(B2OC(C)(C)C(C)(C)O2)cc1CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H29BN2O5/c1-16(2,3)24-15(22)21-10-12-9-13(11-20-14(12)23-8)19-25-17(4,5)18(6,7)26-19/h9,11H,10H2,1-8H3,(H,21,22) |
| InChIKey | NEJAVFWSTKIRHO-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.25 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|