C19H31BN2O6 — CID 170833154
tert-butyl N-[2,3-dihydroxy-3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]propyl]carbamate (PubChem CID 170833154) has the molecular formula C19H31BN2O6 and a molecular weight of 394.28 g/mol. Its IUPAC name is tert-butyl N-[2,3-dihydroxy-3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]propyl]carbamate.
| Compound Name | tert-butyl N-[2,3-dihydroxy-3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]propyl]carbamate |
|---|---|
| PubChem CID | 170833154 |
| Molecular Formula | C19H31BN2O6 |
| Molecular Weight | 394.28 g/mol |
| Exact Mass | 394.23 |
| IUPAC Name | tert-butyl N-[2,3-dihydroxy-3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(O)C(O)c1cncc(B2OC(C)(C)C(C)(C)O2)c1 |
| InChI | InChI=1S/C19H31BN2O6/c1-17(2,3)26-16(25)22-11-14(23)15(24)12-8-13(10-21-9-12)20-27-18(4,5)19(6,7)28-20/h8-10,14-15,23-24H,11H2,1-7H3,(H,22,25) |
| InChIKey | MMDJFKHOEGOPBN-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 110.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.28 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|